C9H20N2O2 — CID 23318253
1-(aminomethyl)-N,N-dihydroxycyclooctan-1-amine (PubChem CID 23318253) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(aminomethyl)-N,N-dihydroxycyclooctan-1-amine.
| Compound Name | 1-(aminomethyl)-N,N-dihydroxycyclooctan-1-amine |
|---|---|
| PubChem CID | 23318253 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1-(aminomethyl)-N,N-dihydroxycyclooctan-1-amine |
| SMILES | NCC1(N(O)O)CCCCCCC1 |
| InChI | InChI=1S/C9H20N2O2/c10-8-9(11(12)13)6-4-2-1-3-5-7-9/h12-13H,1-8,10H2 |
| InChIKey | MRRDWMUKTYPGJN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|