About ethylaminothiourea;N-methylmethanamine
ethylaminothiourea;N-methylmethanamine (PubChem CID 23318727) has the molecular formula C5H16N4S
and a molecular weight of 164.28 g/mol. Its IUPAC name is ethylaminothiourea;N-methylmethanamine.
Molecular Properties
| Compound Name | ethylaminothiourea;N-methylmethanamine |
| PubChem CID | 23318727 |
| Molecular Formula | C5H16N4S |
| Molecular Weight | 164.28 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | ethylaminothiourea;N-methylmethanamine |
| SMILES | CCNNC(N)=S.CNC |
| InChI | InChI=1S/C3H9N3S.C2H7N/c1-2-5-6-3(4)7;1-3-2/h5H,2H2,1H3,(H3,4,6,7);3H,1-2H3 |
| InChIKey | LSPCHDPJZVTDEM-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylaminothiourea;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylaminothiourea;N-methylmethanamine?
The IUPAC name of ethylaminothiourea;N-methylmethanamine (CID 23318727) is ethylaminothiourea;N-methylmethanamine.
What is the SMILES notation for ethylaminothiourea;N-methylmethanamine?
The canonical SMILES for ethylaminothiourea;N-methylmethanamine is CCNNC(N)=S.CNC.
What is the InChIKey of ethylaminothiourea;N-methylmethanamine?
The InChIKey is LSPCHDPJZVTDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3S.C2H7N/c1-2-5-6-3(4)7;1-3-2/h5H,2H2,1H3,(H3,4,6,7);3H,1-2H3.
What are the key properties of ethylaminothiourea;N-methylmethanamine?
ethylaminothiourea;N-methylmethanamine has a molecular weight of 164.28 g/mol, XLogP of -0.82, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylaminothiourea;N-methylmethanamine is sourced from PubChem (CID 23318727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).