About 2,3-diiodopropan-1-ol
2,3-diiodopropan-1-ol (PubChem CID 23319843) has the molecular formula C3H6I2O
and a molecular weight of 311.89 g/mol. Its IUPAC name is 2,3-diiodopropan-1-ol.
Molecular Properties
| Compound Name | 2,3-diiodopropan-1-ol |
| PubChem CID | 23319843 |
| Molecular Formula | C3H6I2O |
| Molecular Weight | 311.89 g/mol |
| Exact Mass | 311.85 |
| IUPAC Name | 2,3-diiodopropan-1-ol |
| SMILES | OCC(I)CI |
| InChI | InChI=1S/C3H6I2O/c4-1-3(5)2-6/h3,6H,1-2H2 |
| InChIKey | YAEIGIBCYKSALO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.89 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiodopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiodopropan-1-ol?
The IUPAC name of 2,3-diiodopropan-1-ol (CID 23319843) is 2,3-diiodopropan-1-ol.
What is the SMILES notation for 2,3-diiodopropan-1-ol?
The canonical SMILES for 2,3-diiodopropan-1-ol is OCC(I)CI.
What is the InChIKey of 2,3-diiodopropan-1-ol?
The InChIKey is YAEIGIBCYKSALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6I2O/c4-1-3(5)2-6/h3,6H,1-2H2.
What are the key properties of 2,3-diiodopropan-1-ol?
2,3-diiodopropan-1-ol has a molecular weight of 311.89 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiodopropan-1-ol is sourced from PubChem (CID 23319843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).