C14H19ClN2O3S — CID 23320212
(E)-N-[2-[4-(2-chloroethylsulfamoyl)phenyl]ethyl]but-2-enamide (PubChem CID 23320212) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is (E)-N-[2-[4-(2-chloroethylsulfamoyl)phenyl]ethyl]but-2-enamide.
| Compound Name | (E)-N-[2-[4-(2-chloroethylsulfamoyl)phenyl]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 23320212 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (E)-N-[2-[4-(2-chloroethylsulfamoyl)phenyl]ethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCc1ccc(S(=O)(=O)NCCCl)cc1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-2-3-14(18)16-10-8-12-4-6-13(7-5-12)21(19,20)17-11-9-15/h2-7,17H,8-11H2,1H3,(H,16,18)/b3-2+ |
| InChIKey | PMUTYKLXULPTTN-NSCUHMNNSA-N |
| XLogP | 1.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|