About 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid
5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid (PubChem CID 23320581) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid |
| PubChem CID | 23320581 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)O)CS1 |
| InChI | InChI=1S/C6H11NO2S/c1-6(2)3-7(4-10-6)5(8)9/h3-4H2,1-2H3,(H,8,9) |
| InChIKey | XXVHKAPKPVGOSX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The IUPAC name of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid (CID 23320581) is 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid.
What is the SMILES notation for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The canonical SMILES for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid is CC1(C)CN(C(=O)O)CS1.
What is the InChIKey of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The InChIKey is XXVHKAPKPVGOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-6(2)3-7(4-10-6)5(8)9/h3-4H2,1-2H3,(H,8,9).
What are the key properties of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid has a molecular weight of 161.23 g/mol, XLogP of 1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid is sourced from PubChem (CID 23320581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).