5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid

C6H11NO2S — CID 23320581

IUPAC5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid
SMILESCC1(C)CN(C(=O)O)CS1
InChIInChI=1S/C6H11NO2S/c1-6(2)3-7(4-10-6)5(8)9/h3-4H2,1-2H3,(H,8,9)
InChIKeyXXVHKAPKPVGOSX-UHFFFAOYSA-N
MW161.23 g/mol
LogP1.45
Rot. Bonds

About 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid

5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid (PubChem CID 23320581) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid.

Molecular Properties

Compound Name5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid
PubChem CID23320581
Molecular FormulaC6H11NO2S
Molecular Weight161.23 g/mol
Exact Mass161.05
IUPAC Name5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid
SMILESCC1(C)CN(C(=O)O)CS1
InChIInChI=1S/C6H11NO2S/c1-6(2)3-7(4-10-6)5(8)9/h3-4H2,1-2H3,(H,8,9)
InChIKeyXXVHKAPKPVGOSX-UHFFFAOYSA-N
XLogP1.45
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.23
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The IUPAC name of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid (CID 23320581) is 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid.
What is the SMILES notation for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The canonical SMILES for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid is CC1(C)CN(C(=O)O)CS1.
What is the InChIKey of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
The InChIKey is XXVHKAPKPVGOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-6(2)3-7(4-10-6)5(8)9/h3-4H2,1-2H3,(H,8,9).
What are the key properties of 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid?
5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid has a molecular weight of 161.23 g/mol, XLogP of 1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid is sourced from PubChem (CID 23320581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).