C21H25Cl2N3O5S — CID 23320831
3-O-ethyl 5-O-methyl 2-[2-(carbamothioylamino)ethoxymethyl]-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23320831) has the molecular formula C21H25Cl2N3O5S and a molecular weight of 502.42 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-[2-(carbamothioylamino)ethoxymethyl]-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 2-[2-(carbamothioylamino)ethoxymethyl]-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23320831 |
| Molecular Formula | C21H25Cl2N3O5S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-[2-(carbamothioylamino)ethoxymethyl]-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(COCCNC(N)=S)NC(C)=C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H25Cl2N3O5S/c1-4-31-20(28)17-14(10-30-9-8-25-21(24)32)26-11(2)15(19(27)29-3)16(17)12-6-5-7-13(22)18(12)23/h5-7,16,26H,4,8-10H2,1-3H3,(H3,24,25,32) |
| InChIKey | YMMOVAHGWYIISH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|