C19H17BrF3N3S — CID 23321016
N-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]-4,5-dihydro-1H-imidazol-2-amine;hydrobromide (PubChem CID 23321016) has the molecular formula C19H17BrF3N3S and a molecular weight of 456.33 g/mol. Its IUPAC name is N-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]-4,5-dihydro-1H-imidazol-2-amine;hydrobromide.
| Compound Name | N-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 23321016 |
| Molecular Formula | C19H17BrF3N3S |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| SMILES | Br.FC(F)(F)Sc1ccc2c(c1)C(NC1=NCCN1)c1ccccc1C=C2 |
| InChI | InChI=1S/C19H16F3N3S.BrH/c20-19(21,22)26-14-8-7-13-6-5-12-3-1-2-4-15(12)17(16(13)11-14)25-18-23-9-10-24-18;/h1-8,11,17H,9-10H2,(H2,23,24,25);1H |
| InChIKey | KIXMLAJPOCYOJA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|