About [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride
[1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride (PubChem CID 23321190) has the molecular formula C15H10ClNS
and a molecular weight of 271.77 g/mol. Its IUPAC name is [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride.
Molecular Properties
| Compound Name | [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride |
| PubChem CID | 23321190 |
| Molecular Formula | C15H10ClNS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride |
| SMILES | [Cl-].c1ccc2c(c1)ccc1sc3ccccc3[n+]12 |
| InChI | InChI=1S/C15H10NS.ClH/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15;/h1-10H;1H/q+1;/p-1 |
| InChIKey | YYRDAUBTSKKGBA-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride?
The IUPAC name of [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride (CID 23321190) is [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride.
What is the SMILES notation for [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride?
The canonical SMILES for [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride is [Cl-].c1ccc2c(c1)ccc1sc3ccccc3[n+]12.
What is the InChIKey of [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride?
The InChIKey is YYRDAUBTSKKGBA-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H10NS.ClH/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15;/h1-10H;1H/q+1;/p-1.
What are the key properties of [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride?
[1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride has a molecular weight of 271.77 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]benzothiazolo[3,2-a]quinolin-12-ium chloride is sourced from PubChem (CID 23321190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).