About 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride
1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride (PubChem CID 23321506) has the molecular formula C12H17ClN2O
and a molecular weight of 240.73 g/mol. Its IUPAC name is 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride |
| PubChem CID | 23321506 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride |
| SMILES | Cl.O=c1c2c(nc3n1CCCCC3)CCC2 |
| InChI | InChI=1S/C12H16N2O.ClH/c15-12-9-5-4-6-10(9)13-11-7-2-1-3-8-14(11)12;/h1-8H2;1H |
| InChIKey | GHIDOCIFJIWUKX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride?
The IUPAC name of 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride (CID 23321506) is 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride.
What is the SMILES notation for 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride?
The canonical SMILES for 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride is Cl.O=c1c2c(nc3n1CCCCC3)CCC2.
What is the InChIKey of 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride?
The InChIKey is GHIDOCIFJIWUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O.ClH/c15-12-9-5-4-6-10(9)13-11-7-2-1-3-8-14(11)12;/h1-8H2;1H.
What are the key properties of 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride?
1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride has a molecular weight of 240.73 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),8-dien-2-one;hydrochloride is sourced from PubChem (CID 23321506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).