C17H22N2O8 — CID 23321611
4-butyl-1-phenylpyrazolidine-3,5-dione;2,3-dihydroxybutanedioic acid (PubChem CID 23321611) has the molecular formula C17H22N2O8 and a molecular weight of 382.37 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;2,3-dihydroxybutanedioic acid.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 23321611 |
| Molecular Formula | C17H22N2O8 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;2,3-dihydroxybutanedioic acid |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C13H16N2O2.C4H6O6/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;5-1(3(7)8)2(6)4(9)10/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | VAEFLEDBGCZMFG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|