About 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione
1-(4-chlorophenyl)-1,3-diazinane-2,4-dione (PubChem CID 23321813) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione |
| PubChem CID | 23321813 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C10H9ClN2O2/c11-7-1-3-8(4-2-7)13-6-5-9(14)12-10(13)15/h1-4H,5-6H2,(H,12,14,15) |
| InChIKey | GVRWSGGTFZNRJQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione?
The IUPAC name of 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione (CID 23321813) is 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione?
The canonical SMILES for 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione is O=C1CCN(c2ccc(Cl)cc2)C(=O)N1.
What is the InChIKey of 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione?
The InChIKey is GVRWSGGTFZNRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c11-7-1-3-8(4-2-7)13-6-5-9(14)12-10(13)15/h1-4H,5-6H2,(H,12,14,15).
What are the key properties of 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione?
1-(4-chlorophenyl)-1,3-diazinane-2,4-dione has a molecular weight of 224.65 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-1,3-diazinane-2,4-dione is sourced from PubChem (CID 23321813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).