C16H18Cl2N2O2 — CID 23321841
1-cyclohexyl-3-(3,4-dichlorophenyl)-1,3-diazinane-2,4-dione (PubChem CID 23321841) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dichlorophenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 23321841 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(C2CCCCC2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c17-13-7-6-12(10-14(13)18)20-15(21)8-9-19(16(20)22)11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2 |
| InChIKey | DLNGZANUYACPST-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |