C17H16N6O2 — CID 23322067
4-(2-aminoethyl)-7-(1-phenyltetrazol-5-yl)oxy-1,3-dihydroindol-2-one (PubChem CID 23322067) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-(2-aminoethyl)-7-(1-phenyltetrazol-5-yl)oxy-1,3-dihydroindol-2-one.
| Compound Name | 4-(2-aminoethyl)-7-(1-phenyltetrazol-5-yl)oxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 23322067 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-(2-aminoethyl)-7-(1-phenyltetrazol-5-yl)oxy-1,3-dihydroindol-2-one |
| SMILES | NCCc1ccc(Oc2nnnn2-c2ccccc2)c2c1CC(=O)N2 |
| InChI | InChI=1S/C17H16N6O2/c18-9-8-11-6-7-14(16-13(11)10-15(24)19-16)25-17-20-21-22-23(17)12-4-2-1-3-5-12/h1-7H,8-10,18H2,(H,19,24) |
| InChIKey | PLKMLNRAUXEIKY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |