About 1-aminopropyl (E)-2-methylhex-2-enoate
1-aminopropyl (E)-2-methylhex-2-enoate (PubChem CID 23322184) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-aminopropyl (E)-2-methylhex-2-enoate.
Molecular Properties
| Compound Name | 1-aminopropyl (E)-2-methylhex-2-enoate |
| PubChem CID | 23322184 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-aminopropyl (E)-2-methylhex-2-enoate |
| SMILES | CCC/C=C(\C)C(=O)OC(N)CC |
| InChI | InChI=1S/C10H19NO2/c1-4-6-7-8(3)10(12)13-9(11)5-2/h7,9H,4-6,11H2,1-3H3/b8-7+ |
| InChIKey | OKEFAXDOBZLKTO-BQYQJAHWSA-N |
| XLogP | 1.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropyl (E)-2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropyl (E)-2-methylhex-2-enoate?
The IUPAC name of 1-aminopropyl (E)-2-methylhex-2-enoate (CID 23322184) is 1-aminopropyl (E)-2-methylhex-2-enoate.
What is the SMILES notation for 1-aminopropyl (E)-2-methylhex-2-enoate?
The canonical SMILES for 1-aminopropyl (E)-2-methylhex-2-enoate is CCC/C=C(\C)C(=O)OC(N)CC.
What is the InChIKey of 1-aminopropyl (E)-2-methylhex-2-enoate?
The InChIKey is OKEFAXDOBZLKTO-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-6-7-8(3)10(12)13-9(11)5-2/h7,9H,4-6,11H2,1-3H3/b8-7+.
What are the key properties of 1-aminopropyl (E)-2-methylhex-2-enoate?
1-aminopropyl (E)-2-methylhex-2-enoate has a molecular weight of 185.27 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropyl (E)-2-methylhex-2-enoate is sourced from PubChem (CID 23322184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).