About 1-phenyl-4H-borinine
1-phenyl-4H-borinine (PubChem CID 23322307) has the molecular formula C11H11B
and a molecular weight of 154.02 g/mol. Its IUPAC name is 1-phenyl-4H-borinine.
Molecular Properties
| Compound Name | 1-phenyl-4H-borinine |
| PubChem CID | 23322307 |
| Molecular Formula | C11H11B |
| Molecular Weight | 154.02 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 1-phenyl-4H-borinine |
| SMILES | C1=CB(c2ccccc2)C=CC1 |
| InChI | InChI=1S/C11H11B/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-10H,2H2 |
| InChIKey | FEYPEDKPQYBDKG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.02 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-4H-borinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4H-borinine?
The IUPAC name of 1-phenyl-4H-borinine (CID 23322307) is 1-phenyl-4H-borinine.
What is the SMILES notation for 1-phenyl-4H-borinine?
The canonical SMILES for 1-phenyl-4H-borinine is C1=CB(c2ccccc2)C=CC1.
What is the InChIKey of 1-phenyl-4H-borinine?
The InChIKey is FEYPEDKPQYBDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11B/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-10H,2H2.
What are the key properties of 1-phenyl-4H-borinine?
1-phenyl-4H-borinine has a molecular weight of 154.02 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4H-borinine is sourced from PubChem (CID 23322307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).