About 1,2-diaminoethyl hydrogen sulfite
1,2-diaminoethyl hydrogen sulfite (PubChem CID 23322422) has the molecular formula C2H8N2O3S
and a molecular weight of 140.16 g/mol. Its IUPAC name is 1,2-diaminoethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 1,2-diaminoethyl hydrogen sulfite |
| PubChem CID | 23322422 |
| Molecular Formula | C2H8N2O3S |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 1,2-diaminoethyl hydrogen sulfite |
| SMILES | NCC(N)OS(=O)O |
| InChI | InChI=1S/C2H8N2O3S/c3-1-2(4)7-8(5)6/h2H,1,3-4H2,(H,5,6) |
| InChIKey | GLLQREOCGSTQBS-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diaminoethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diaminoethyl hydrogen sulfite?
The IUPAC name of 1,2-diaminoethyl hydrogen sulfite (CID 23322422) is 1,2-diaminoethyl hydrogen sulfite.
What is the SMILES notation for 1,2-diaminoethyl hydrogen sulfite?
The canonical SMILES for 1,2-diaminoethyl hydrogen sulfite is NCC(N)OS(=O)O.
What is the InChIKey of 1,2-diaminoethyl hydrogen sulfite?
The InChIKey is GLLQREOCGSTQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2O3S/c3-1-2(4)7-8(5)6/h2H,1,3-4H2,(H,5,6).
What are the key properties of 1,2-diaminoethyl hydrogen sulfite?
1,2-diaminoethyl hydrogen sulfite has a molecular weight of 140.16 g/mol, XLogP of -1.62, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diaminoethyl hydrogen sulfite is sourced from PubChem (CID 23322422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).