About 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid
2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid (PubChem CID 23322538) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid |
| PubChem CID | 23322538 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1/C=C\C=C/C=C(/N)C1=O |
| InChI | InChI=1S/C10H12N2O3/c1-7(10(14)15)12-6-4-2-3-5-8(11)9(12)13/h2-7H,11H2,1H3,(H,14,15)/b3-2-,6-4-,8-5+ |
| InChIKey | TWBAUIYLDRAAJT-ZVMWILNTSA-N |
| XLogP | 0.21 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid?
The IUPAC name of 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid (CID 23322538) is 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid.
What is the SMILES notation for 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid?
The canonical SMILES for 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid is CC(C(=O)O)N1/C=C\C=C/C=C(/N)C1=O.
What is the InChIKey of 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid?
The InChIKey is TWBAUIYLDRAAJT-ZVMWILNTSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-7(10(14)15)12-6-4-2-3-5-8(11)9(12)13/h2-7H,11H2,1H3,(H,14,15)/b3-2-,6-4-,8-5+.
What are the key properties of 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid?
2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid has a molecular weight of 208.22 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E,5Z,7Z)-3-amino-2-oxoazocin-1-yl]propanoic acid is sourced from PubChem (CID 23322538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).