C9H15NO — CID 23322740
(5Z)-2-methyl-1,2,3,4,7,8-hexahydroazonin-9-one (PubChem CID 23322740) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is (5Z)-2-methyl-1,2,3,4,7,8-hexahydroazonin-9-one.
| Compound Name | (5Z)-2-methyl-1,2,3,4,7,8-hexahydroazonin-9-one |
|---|---|
| PubChem CID | 23322740 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (5Z)-2-methyl-1,2,3,4,7,8-hexahydroazonin-9-one |
| SMILES | CC1CC/C=C\CCC(=O)N1 |
| InChI | InChI=1S/C9H15NO/c1-8-6-4-2-3-5-7-9(11)10-8/h2-3,8H,4-7H2,1H3,(H,10,11)/b3-2- |
| InChIKey | GUSAAWXVUUYJPE-IHWYPQMZSA-N |
| XLogP | 1.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|