About hydron;pentanedioate
hydron;pentanedioate (PubChem CID 23322899) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is hydron;pentanedioate.
Molecular Properties
| Compound Name | hydron;pentanedioate |
| PubChem CID | 23322899 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | hydron;pentanedioate |
| SMILES | O=C([O-])CCCC(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9) |
| InChIKey | JFCQEDHGNNZCLN-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hydron;pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pentanedioate?
The IUPAC name of hydron;pentanedioate (CID 23322899) is hydron;pentanedioate.
What is the SMILES notation for hydron;pentanedioate?
The canonical SMILES for hydron;pentanedioate is O=C([O-])CCCC(=O)[O-].[H+].[H+].
What is the InChIKey of hydron;pentanedioate?
The InChIKey is JFCQEDHGNNZCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9).
What are the key properties of hydron;pentanedioate?
hydron;pentanedioate has a molecular weight of 132.12 g/mol, XLogP of -2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pentanedioate is sourced from PubChem (CID 23322899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).