About 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine
5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 23323057) has the molecular formula C15H15N5O
and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
| PubChem CID | 23323057 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc2cccnc12 |
| InChI | InChI=1S/C15H15N5O/c1-21-12-7-9(5-10-3-2-4-18-13(10)12)6-11-8-19-15(17)20-14(11)16/h2-5,7-8H,6H2,1H3,(H4,16,17,19,20) |
| InChIKey | SWFUEQPLVRLTCU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine (CID 23323057) is 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine is COc1cc(Cc2cnc(N)nc2N)cc2cccnc12.
What is the InChIKey of 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine?
The InChIKey is SWFUEQPLVRLTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O/c1-21-12-7-9(5-10-3-2-4-18-13(10)12)6-11-8-19-15(17)20-14(11)16/h2-5,7-8H,6H2,1H3,(H4,16,17,19,20).
What are the key properties of 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine?
5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine has a molecular weight of 281.32 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 23323057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).