About 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide
3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide (PubChem CID 23323127) has the molecular formula C21H27F3N2O4S
and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| PubChem CID | 23323127 |
| Molecular Formula | C21H27F3N2O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| SMILES | COc1ccc(CCCNCCCS(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C21H27F3N2O4S/c1-29-19-10-9-16(14-20(19)30-2)6-4-11-25-12-5-13-31(27,28)26-18-8-3-7-17(15-18)21(22,23)24/h3,7-10,14-15,25-26H,4-6,11-13H2,1-2H3 |
| InChIKey | QGKIMKUQVUBHPH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide?
The IUPAC name of 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide (CID 23323127) is 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide.
What is the SMILES notation for 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide?
The canonical SMILES for 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide is COc1ccc(CCCNCCCS(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1OC.
What is the InChIKey of 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide?
The InChIKey is QGKIMKUQVUBHPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F3N2O4S/c1-29-19-10-9-16(14-20(19)30-2)6-4-11-25-12-5-13-31(27,28)26-18-8-3-7-17(15-18)21(22,23)24/h3,7-10,14-15,25-26H,4-6,11-13H2,1-2H3.
What are the key properties of 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide?
3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide has a molecular weight of 460.52 g/mol, XLogP of 4.08, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,4-dimethoxyphenyl)propylamino]-N-[3-(trifluoromethyl)phenyl]propane-1-sulfonamide is sourced from PubChem (CID 23323127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).