C21H25ClN4O6 — CID 23323553
2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide;hydrochloride (PubChem CID 23323553) has the molecular formula C21H25ClN4O6 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 23323553 |
| Molecular Formula | C21H25ClN4O6 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide;hydrochloride |
| SMILES | COc1ccc(C(=O)N2CCN(CC(=O)Nc3ccccc3[N+](=O)[O-])CC2)cc1OC.Cl |
| InChI | InChI=1S/C21H24N4O6.ClH/c1-30-18-8-7-15(13-19(18)31-2)21(27)24-11-9-23(10-12-24)14-20(26)22-16-5-3-4-6-17(16)25(28)29;/h3-8,13H,9-12,14H2,1-2H3,(H,22,26);1H |
| InChIKey | LXPMUVIXDQCSSE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|