About 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol
1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol (PubChem CID 23323776) has the molecular formula C18H21ClFNO
and a molecular weight of 321.82 g/mol. Its IUPAC name is 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol |
| PubChem CID | 23323776 |
| Molecular Formula | C18H21ClFNO |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)CC1.Fc1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H8ClF.C6H13NO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;1-7-4-2-6(8)3-5-7/h1-8H;6,8H,2-5H2,1H3 |
| InChIKey | YSHYSGSKHZEDRQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol?
The IUPAC name of 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol (CID 23323776) is 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol.
What is the SMILES notation for 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol?
The canonical SMILES for 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol is CN1CCC(O)CC1.Fc1ccccc1-c1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol?
The InChIKey is YSHYSGSKHZEDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF.C6H13NO/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;1-7-4-2-6(8)3-5-7/h1-8H;6,8H,2-5H2,1H3.
What are the key properties of 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol?
1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol has a molecular weight of 321.82 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(2-fluorophenyl)benzene;1-methylpiperidin-4-ol is sourced from PubChem (CID 23323776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).