C14H32N2O2S — CID 23323940
2,3,3-trimethyl-N-(2,3,3-trimethylbutylsulfamoyl)butan-1-amine (PubChem CID 23323940) has the molecular formula C14H32N2O2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 2,3,3-trimethyl-N-(2,3,3-trimethylbutylsulfamoyl)butan-1-amine.
| Compound Name | 2,3,3-trimethyl-N-(2,3,3-trimethylbutylsulfamoyl)butan-1-amine |
|---|---|
| PubChem CID | 23323940 |
| Molecular Formula | C14H32N2O2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2,3,3-trimethyl-N-(2,3,3-trimethylbutylsulfamoyl)butan-1-amine |
| SMILES | CC(CNS(=O)(=O)NCC(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32N2O2S/c1-11(13(3,4)5)9-15-19(17,18)16-10-12(2)14(6,7)8/h11-12,15-16H,9-10H2,1-8H3 |
| InChIKey | YTWGFXGBWHEELN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |