C21H38O2Si2 — CID 23324279
trimethyl-[(1E)-3-methyl-1-(2,6,6-trimethyl-3-trimethylsilyloxycyclohexa-1,3-dien-1-yl)penta-1,4-dien-3-yl]oxysilane (PubChem CID 23324279) has the molecular formula C21H38O2Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is trimethyl-[(1E)-3-methyl-1-(2,6,6-trimethyl-3-trimethylsilyloxycyclohexa-1,3-dien-1-yl)penta-1,4-dien-3-yl]oxysilane.
| Compound Name | trimethyl-[(1E)-3-methyl-1-(2,6,6-trimethyl-3-trimethylsilyloxycyclohexa-1,3-dien-1-yl)penta-1,4-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 23324279 |
| Molecular Formula | C21H38O2Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | trimethyl-[(1E)-3-methyl-1-(2,6,6-trimethyl-3-trimethylsilyloxycyclohexa-1,3-dien-1-yl)penta-1,4-dien-3-yl]oxysilane |
| SMILES | C=CC(C)(/C=C/C1=C(C)C(O[Si](C)(C)C)=CCC1(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H38O2Si2/c1-12-21(5,23-25(9,10)11)16-13-18-17(2)19(22-24(6,7)8)14-15-20(18,3)4/h12-14,16H,1,15H2,2-11H3/b16-13+ |
| InChIKey | VIVQNMJDYRYOIS-DTQAZKPQSA-N |
| XLogP | 6.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|