C15H10F17NO4 — CID 23324463
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 23324463) has the molecular formula C15H10F17NO4 and a molecular weight of 591.21 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxycarbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxycarbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23324463 |
| Molecular Formula | C15H10F17NO4 |
| Molecular Weight | 591.21 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H10F17NO4/c1-5(2)6(34)36-4-3-33-7(35)37-15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h1,3-4H2,2H3,(H,33,35) |
| InChIKey | CPMYUWNPZVPYTO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.21 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|