C27H37N3O5 — CID 23324585
3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7,8-dimethoxy-4,5-dihydro-1H-1,3-benzodiazepin-2-one (PubChem CID 23324585) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7,8-dimethoxy-4,5-dihydro-1H-1,3-benzodiazepin-2-one.
| Compound Name | 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7,8-dimethoxy-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23324585 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7,8-dimethoxy-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
| SMILES | COc1cc2c(cc1OC)CC(N(C)CCCN1CCc3cc(OC)c(OC)cc3NC1=O)CC2 |
| InChI | InChI=1S/C27H37N3O5/c1-29(21-8-7-18-14-23(32-2)25(34-4)16-20(18)13-21)10-6-11-30-12-9-19-15-24(33-3)26(35-5)17-22(19)28-27(30)31/h14-17,21H,6-13H2,1-5H3,(H,28,31) |
| InChIKey | XDZWSXGDVKWLJR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |