About 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine
4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine (PubChem CID 23324624) has the molecular formula C15H27N2O4PS2
and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine.
Molecular Properties
| Compound Name | 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine |
| PubChem CID | 23324624 |
| Molecular Formula | C15H27N2O4PS2 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine |
| SMILES | CCOc1cc(CSP(=O)(OCC)SC(C)CC)nc(OCC)n1 |
| InChI | InChI=1S/C15H27N2O4PS2/c1-6-12(5)24-22(18,21-9-4)23-11-13-10-14(19-7-2)17-15(16-13)20-8-3/h10,12H,6-9,11H2,1-5H3 |
| InChIKey | DQGVCGWCUWHSFQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine?
The IUPAC name of 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine (CID 23324624) is 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine.
What is the SMILES notation for 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine?
The canonical SMILES for 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine is CCOc1cc(CSP(=O)(OCC)SC(C)CC)nc(OCC)n1.
What is the InChIKey of 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine?
The InChIKey is DQGVCGWCUWHSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N2O4PS2/c1-6-12(5)24-22(18,21-9-4)23-11-13-10-14(19-7-2)17-15(16-13)20-8-3/h10,12H,6-9,11H2,1-5H3.
What are the key properties of 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine?
4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine has a molecular weight of 394.50 g/mol, XLogP of 5.18, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[butan-2-ylsulfanyl(ethoxy)phosphoryl]sulfanylmethyl]-2,6-diethoxypyrimidine is sourced from PubChem (CID 23324624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).