About 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine
5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine (PubChem CID 23324629) has the molecular formula C9H12Cl2N2O2
and a molecular weight of 251.11 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine.
Molecular Properties
| Compound Name | 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine |
| PubChem CID | 23324629 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine |
| SMILES | CCOc1nc(CCl)c(Cl)c(OCC)n1 |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-3-14-8-7(11)6(5-10)12-9(13-8)15-4-2/h3-5H2,1-2H3 |
| InChIKey | OPJLIQYYEDLZMS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine?
The IUPAC name of 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine (CID 23324629) is 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine.
What is the SMILES notation for 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine?
The canonical SMILES for 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine is CCOc1nc(CCl)c(Cl)c(OCC)n1.
What is the InChIKey of 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine?
The InChIKey is OPJLIQYYEDLZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O2/c1-3-14-8-7(11)6(5-10)12-9(13-8)15-4-2/h3-5H2,1-2H3.
What are the key properties of 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine?
5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine has a molecular weight of 251.11 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(chloromethyl)-2,6-diethoxypyrimidine is sourced from PubChem (CID 23324629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).