C20H31FN6O2 — CID 23324765
N-[1-[2-(4-ethyl-5H-tetrazol-1-yl)ethyl]-3-methylpiperidin-4-yl]-N-[(2-fluorophenyl)methoxy]acetamide (PubChem CID 23324765) has the molecular formula C20H31FN6O2 and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[1-[2-(4-ethyl-5H-tetrazol-1-yl)ethyl]-3-methylpiperidin-4-yl]-N-[(2-fluorophenyl)methoxy]acetamide.
| Compound Name | N-[1-[2-(4-ethyl-5H-tetrazol-1-yl)ethyl]-3-methylpiperidin-4-yl]-N-[(2-fluorophenyl)methoxy]acetamide |
|---|---|
| PubChem CID | 23324765 |
| Molecular Formula | C20H31FN6O2 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | N-[1-[2-(4-ethyl-5H-tetrazol-1-yl)ethyl]-3-methylpiperidin-4-yl]-N-[(2-fluorophenyl)methoxy]acetamide |
| SMILES | CCN1CN(CCN2CCC(N(OCc3ccccc3F)C(C)=O)C(C)C2)N=N1 |
| InChI | InChI=1S/C20H31FN6O2/c1-4-25-15-26(23-22-25)12-11-24-10-9-20(16(2)13-24)27(17(3)28)29-14-18-7-5-6-8-19(18)21/h5-8,16,20H,4,9-15H2,1-3H3 |
| InChIKey | JYJIBDWYCGBHLI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|