About 2,2-dimethylazasilolidine
2,2-dimethylazasilolidine (PubChem CID 23325066) has the molecular formula C5H13NSi
and a molecular weight of 115.25 g/mol. Its IUPAC name is 2,2-dimethylazasilolidine.
Molecular Properties
| Compound Name | 2,2-dimethylazasilolidine |
| PubChem CID | 23325066 |
| Molecular Formula | C5H13NSi |
| Molecular Weight | 115.25 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | 2,2-dimethylazasilolidine |
| SMILES | C[Si]1(C)CCCN1 |
| InChI | InChI=1S/C5H13NSi/c1-7(2)5-3-4-6-7/h6H,3-5H2,1-2H3 |
| InChIKey | CHWUNMMSSFJWJF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylazasilolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylazasilolidine?
The IUPAC name of 2,2-dimethylazasilolidine (CID 23325066) is 2,2-dimethylazasilolidine.
What is the SMILES notation for 2,2-dimethylazasilolidine?
The canonical SMILES for 2,2-dimethylazasilolidine is C[Si]1(C)CCCN1.
What is the InChIKey of 2,2-dimethylazasilolidine?
The InChIKey is CHWUNMMSSFJWJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NSi/c1-7(2)5-3-4-6-7/h6H,3-5H2,1-2H3.
What are the key properties of 2,2-dimethylazasilolidine?
2,2-dimethylazasilolidine has a molecular weight of 115.25 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylazasilolidine is sourced from PubChem (CID 23325066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).