C19H17F6NO5 — CID 2332516
[2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 2332516) has the molecular formula C19H17F6NO5 and a molecular weight of 453.34 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2332516 |
| Molecular Formula | C19H17F6NO5 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [2-(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC(c2ccc(N)cc2)(C(F)(F)F)C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C19H17F6NO5/c1-28-13-8-10(9-14(29-2)15(13)30-3)16(27)31-17(18(20,21)22,19(23,24)25)11-4-6-12(26)7-5-11/h4-9H,26H2,1-3H3 |
| InChIKey | BOOMJLCXVSXEJM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|