C20H20N2O5S — CID 23325383
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] formate (PubChem CID 23325383) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] formate.
| Compound Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] formate |
|---|---|
| PubChem CID | 23325383 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] formate |
| SMILES | CCc1ccc(C(COc2ccc(CC3NC(=O)SC3=O)cc2)OC=O)nc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-2-13-5-8-16(21-10-13)18(27-12-23)11-26-15-6-3-14(4-7-15)9-17-19(24)28-20(25)22-17/h3-8,10,12,17-18H,2,9,11H2,1H3,(H,22,25) |
| InChIKey | CPHDIIXEMKLEET-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|