C24H28N2O5S — CID 23325389
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] pentanoate (PubChem CID 23325389) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] pentanoate.
| Compound Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] pentanoate |
|---|---|
| PubChem CID | 23325389 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] pentanoate |
| SMILES | CCCCC(=O)OC(COc1ccc(CC2NC(=O)SC2=O)cc1)c1ccc(CC)cn1 |
| InChI | InChI=1S/C24H28N2O5S/c1-3-5-6-22(27)31-21(19-12-9-16(4-2)14-25-19)15-30-18-10-7-17(8-11-18)13-20-23(28)32-24(29)26-20/h7-12,14,20-21H,3-6,13,15H2,1-2H3,(H,26,29) |
| InChIKey | UKUNVSGYCRZMPR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|