C23H26N2O5S — CID 23325390
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2-methylpropanoate (PubChem CID 23325390) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2-methylpropanoate.
| Compound Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 23325390 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-ethyl-2-pyridinyl)ethyl] 2-methylpropanoate |
| SMILES | CCc1ccc(C(COc2ccc(CC3NC(=O)SC3=O)cc2)OC(=O)C(C)C)nc1 |
| InChI | InChI=1S/C23H26N2O5S/c1-4-15-7-10-18(24-12-15)20(30-21(26)14(2)3)13-29-17-8-5-16(6-9-17)11-19-22(27)31-23(28)25-19/h5-10,12,14,19-20H,4,11,13H2,1-3H3,(H,25,28) |
| InChIKey | QGVLZYSWEPTHEA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|