About [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate (PubChem CID 23325392) has the molecular formula C24H20N2O5S
and a molecular weight of 448.50 g/mol. Its IUPAC name is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate.
Molecular Properties
| Compound Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate |
| PubChem CID | 23325392 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate |
| SMILES | O=C1NC(Cc2ccc(OCC(OC(=O)c3ccccc3)c3ccccn3)cc2)C(=O)S1 |
| InChI | InChI=1S/C24H20N2O5S/c27-22(17-6-2-1-3-7-17)31-21(19-8-4-5-13-25-19)15-30-18-11-9-16(10-12-18)14-20-23(28)32-24(29)26-20/h1-13,20-21H,14-15H2,(H,26,29) |
| InChIKey | SOZMKISFQQSFEA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate?
The IUPAC name of [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate (CID 23325392) is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate.
What is the SMILES notation for [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate?
The canonical SMILES for [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate is O=C1NC(Cc2ccc(OCC(OC(=O)c3ccccc3)c3ccccn3)cc2)C(=O)S1.
What is the InChIKey of [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate?
The InChIKey is SOZMKISFQQSFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O5S/c27-22(17-6-2-1-3-7-17)31-21(19-8-4-5-13-25-19)15-30-18-11-9-16(10-12-18)14-20-23(28)32-24(29)26-20/h1-13,20-21H,14-15H2,(H,26,29).
What are the key properties of [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate?
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate has a molecular weight of 448.50 g/mol, XLogP of 3.95, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-pyridin-2-ylethyl] benzoate is sourced from PubChem (CID 23325392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).