C25H22N2O5S — CID 23325397
[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-methyl-2-pyridinyl)ethyl] benzoate (PubChem CID 23325397) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-methyl-2-pyridinyl)ethyl] benzoate.
| Compound Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-methyl-2-pyridinyl)ethyl] benzoate |
|---|---|
| PubChem CID | 23325397 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]-1-(5-methyl-2-pyridinyl)ethyl] benzoate |
| SMILES | Cc1ccc(C(COc2ccc(CC3NC(=O)SC3=O)cc2)OC(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C25H22N2O5S/c1-16-7-12-20(26-14-16)22(32-23(28)18-5-3-2-4-6-18)15-31-19-10-8-17(9-11-19)13-21-24(29)33-25(30)27-21/h2-12,14,21-22H,13,15H2,1H3,(H,27,30) |
| InChIKey | DUCCTHWKFYRYDV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|