C18H18N2O4S — CID 23325406
4-[[4-[2-hydroxy-2-(5-methyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 23325406) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[[4-[2-hydroxy-2-(5-methyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-hydroxy-2-(5-methyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 23325406 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[[4-[2-hydroxy-2-(5-methyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1ccc(C(O)COc2ccc(CC3NC(=O)SC3=O)cc2)nc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-2-7-14(19-9-11)16(21)10-24-13-5-3-12(4-6-13)8-15-17(22)25-18(23)20-15/h2-7,9,15-16,21H,8,10H2,1H3,(H,20,23) |
| InChIKey | QMJFEIMKMLHIAJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|