About 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid
2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 23325418) has the molecular formula C15H14N2O6
and a molecular weight of 318.29 g/mol. Its IUPAC name is 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 23325418 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)CC(C(=O)O)=C(C)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N2O6/c1-8-12(14(18)19)7-13(15(20)21)9(2)16(8)10-3-5-11(6-4-10)17(22)23/h3-6H,7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | AWEPWDFJKQPFBY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (CID 23325418) is 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid is CC1=C(C(=O)O)CC(C(=O)O)=C(C)N1c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
The InChIKey is AWEPWDFJKQPFBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O6/c1-8-12(14(18)19)7-13(15(20)21)9(2)16(8)10-3-5-11(6-4-10)17(22)23/h3-6H,7H2,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid?
2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid has a molecular weight of 318.29 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 23325418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).