fluoroform;formic acid

C2H3F3O2 — CID 23325859

IUPACfluoroform;formic acid
SMILESFC(F)F.O=CO
InChIInChI=1S/CHF3.CH2O2/c2-1(3)4;2-1-3/h1H;1H,(H,2,3)
InChIKeyLLOUMKLKLBKEJJ-UHFFFAOYSA-N
MW116.04 g/mol
LogP0.88
Rot. Bonds

About fluoroform;formic acid

fluoroform;formic acid (PubChem CID 23325859) has the molecular formula C2H3F3O2 and a molecular weight of 116.04 g/mol. Its IUPAC name is fluoroform;formic acid.

Molecular Properties

Compound Namefluoroform;formic acid
PubChem CID23325859
Molecular FormulaC2H3F3O2
Molecular Weight116.04 g/mol
Exact Mass116.01
IUPAC Namefluoroform;formic acid
SMILESFC(F)F.O=CO
InChIInChI=1S/CHF3.CH2O2/c2-1(3)4;2-1-3/h1H;1H,(H,2,3)
InChIKeyLLOUMKLKLBKEJJ-UHFFFAOYSA-N
XLogP0.88
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.04
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze fluoroform;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoroform;formic acid?
The IUPAC name of fluoroform;formic acid (CID 23325859) is fluoroform;formic acid.
What is the SMILES notation for fluoroform;formic acid?
The canonical SMILES for fluoroform;formic acid is FC(F)F.O=CO.
What is the InChIKey of fluoroform;formic acid?
The InChIKey is LLOUMKLKLBKEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.CH2O2/c2-1(3)4;2-1-3/h1H;1H,(H,2,3).
What are the key properties of fluoroform;formic acid?
fluoroform;formic acid has a molecular weight of 116.04 g/mol, XLogP of 0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;formic acid is sourced from PubChem (CID 23325859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).