C13H20BrNO5S — CID 23325885
2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonic acid;4,5-dihydro-1,3-oxazole (PubChem CID 23325885) has the molecular formula C13H20BrNO5S and a molecular weight of 382.28 g/mol. Its IUPAC name is 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonic acid;4,5-dihydro-1,3-oxazole.
| Compound Name | 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonic acid;4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 23325885 |
| Molecular Formula | C13H20BrNO5S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonic acid;4,5-dihydro-1,3-oxazole |
| SMILES | C1=NCCO1.CC12CCC(C1(C)C)C(Br)(S(=O)(=O)O)C2=O |
| InChI | InChI=1S/C10H15BrO4S.C3H5NO/c1-8(2)6-4-5-9(8,3)7(12)10(6,11)16(13,14)15;1-2-5-3-4-1/h6H,4-5H2,1-3H3,(H,13,14,15);3H,1-2H2 |
| InChIKey | DFEZLRPIJANCPZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|