C12H9NO4 — CID 23326342
6-(4-nitrophenoxy)hexa-2,4-diyn-1-ol (PubChem CID 23326342) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 6-(4-nitrophenoxy)hexa-2,4-diyn-1-ol.
| Compound Name | 6-(4-nitrophenoxy)hexa-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 23326342 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-(4-nitrophenoxy)hexa-2,4-diyn-1-ol |
| SMILES | O=[N+]([O-])c1ccc(OCC#CC#CCO)cc1 |
| InChI | InChI=1S/C12H9NO4/c14-9-3-1-2-4-10-17-12-7-5-11(6-8-12)13(15)16/h5-8,14H,9-10H2 |
| InChIKey | AHQBHMPWHXRYPP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|