C10H8N4O6S2 — CID 23326366
2,6-bis(methylsulfonyl)-3,5-dihydroimidazo[4,5-f]benzimidazole-4,8-dione (PubChem CID 23326366) has the molecular formula C10H8N4O6S2 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2,6-bis(methylsulfonyl)-3,5-dihydroimidazo[4,5-f]benzimidazole-4,8-dione.
| Compound Name | 2,6-bis(methylsulfonyl)-3,5-dihydroimidazo[4,5-f]benzimidazole-4,8-dione |
|---|---|
| PubChem CID | 23326366 |
| Molecular Formula | C10H8N4O6S2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2,6-bis(methylsulfonyl)-3,5-dihydroimidazo[4,5-f]benzimidazole-4,8-dione |
| SMILES | CS(=O)(=O)c1nc2c([nH]1)C(=O)c1[nH]c(S(C)(=O)=O)nc1C2=O |
| InChI | InChI=1S/C10H8N4O6S2/c1-21(17,18)9-11-3-4(12-9)8(16)6-5(7(3)15)13-10(14-6)22(2,19)20/h1-2H3,(H,11,12)(H,13,14) |
| InChIKey | AQXURWUWOMKABD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 159.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|