C10H10F4O3S — CID 23326379
3-methyl-4-(2,2,3,3-tetrafluoropropylsulfonyl)phenol (PubChem CID 23326379) has the molecular formula C10H10F4O3S and a molecular weight of 286.25 g/mol. Its IUPAC name is 3-methyl-4-(2,2,3,3-tetrafluoropropylsulfonyl)phenol.
| Compound Name | 3-methyl-4-(2,2,3,3-tetrafluoropropylsulfonyl)phenol |
|---|---|
| PubChem CID | 23326379 |
| Molecular Formula | C10H10F4O3S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-methyl-4-(2,2,3,3-tetrafluoropropylsulfonyl)phenol |
| SMILES | Cc1cc(O)ccc1S(=O)(=O)CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F4O3S/c1-6-4-7(15)2-3-8(6)18(16,17)5-10(13,14)9(11)12/h2-4,9,15H,5H2,1H3 |
| InChIKey | STVLLHYETXTJIR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|