C27H35N3O — CID 2332670
(3Z,5Z)-3,5-bis[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1-ethylpiperidin-4-one (PubChem CID 2332670) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1-ethylpiperidin-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1-ethylpiperidin-4-one |
|---|---|
| PubChem CID | 2332670 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1-ethylpiperidin-4-one |
| SMILES | CCN1C/C(=C/c2cc(C)n(C3CC3)c2C)C(=O)/C(=C\c2cc(C)n(C3CC3)c2C)C1 |
| InChI | InChI=1S/C27H35N3O/c1-6-28-15-23(13-21-11-17(2)29(19(21)4)25-7-8-25)27(31)24(16-28)14-22-12-18(3)30(20(22)5)26-9-10-26/h11-14,25-26H,6-10,15-16H2,1-5H3/b23-13-,24-14- |
| InChIKey | YIHLOHRONKFZFI-GACBQCINSA-N |
| XLogP | 5.56 |
| TPSA | 30.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|