C7H11F3N2O2S — CID 23326898
3,3,3-trifluoro-2-[[methyl(methylcarbamothioyl)amino]methyl]propanoic acid (PubChem CID 23326898) has the molecular formula C7H11F3N2O2S and a molecular weight of 244.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[methyl(methylcarbamothioyl)amino]methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[[methyl(methylcarbamothioyl)amino]methyl]propanoic acid |
|---|---|
| PubChem CID | 23326898 |
| Molecular Formula | C7H11F3N2O2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3,3,3-trifluoro-2-[[methyl(methylcarbamothioyl)amino]methyl]propanoic acid |
| SMILES | CNC(=S)N(C)CC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S/c1-11-6(15)12(2)3-4(5(13)14)7(8,9)10/h4H,3H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | URPGAZZOWPLTOU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|