C9H9F9N2O3 — CID 23326942
3,3,4,4,5,5,6,6,6-nonafluoro-2-[(methylcarbamoylamino)methyl]hexanoic acid (PubChem CID 23326942) has the molecular formula C9H9F9N2O3 and a molecular weight of 364.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluoro-2-[(methylcarbamoylamino)methyl]hexanoic acid.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluoro-2-[(methylcarbamoylamino)methyl]hexanoic acid |
|---|---|
| PubChem CID | 23326942 |
| Molecular Formula | C9H9F9N2O3 |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluoro-2-[(methylcarbamoylamino)methyl]hexanoic acid |
| SMILES | CNC(=O)NCC(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9N2O3/c1-19-5(23)20-2-3(4(21)22)6(10,11)7(12,13)8(14,15)9(16,17)18/h3H,2H2,1H3,(H,21,22)(H2,19,20,23) |
| InChIKey | YGEKCXDQBYWHEG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|