About 1,2,2-triphenylethenamine
1,2,2-triphenylethenamine (PubChem CID 23327732) has the molecular formula C20H17N
and a molecular weight of 271.36 g/mol. Its IUPAC name is 1,2,2-triphenylethenamine.
Molecular Properties
| Compound Name | 1,2,2-triphenylethenamine |
| PubChem CID | 23327732 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1,2,2-triphenylethenamine |
| SMILES | NC(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H,21H2 |
| InChIKey | KEQFAIKLHXZWIW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-triphenylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-triphenylethenamine?
The IUPAC name of 1,2,2-triphenylethenamine (CID 23327732) is 1,2,2-triphenylethenamine.
What is the SMILES notation for 1,2,2-triphenylethenamine?
The canonical SMILES for 1,2,2-triphenylethenamine is NC(=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2,2-triphenylethenamine?
The InChIKey is KEQFAIKLHXZWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H,21H2.
What are the key properties of 1,2,2-triphenylethenamine?
1,2,2-triphenylethenamine has a molecular weight of 271.36 g/mol, XLogP of 4.56, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-triphenylethenamine is sourced from PubChem (CID 23327732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).