C20H25FN2O2 — CID 23327867
4-(4-fluorophenyl)-4-oxo-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide (PubChem CID 23327867) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-oxo-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide.
| Compound Name | 4-(4-fluorophenyl)-4-oxo-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
|---|---|
| PubChem CID | 23327867 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-(4-fluorophenyl)-4-oxo-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/NC(=O)CCC(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C20H25FN2O2/c1-19(2)14-10-11-20(19,3)17(12-14)22-23-18(25)9-8-16(24)13-4-6-15(21)7-5-13/h4-7,14H,8-12H2,1-3H3,(H,23,25)/b22-17+/t14-,20-/m1/s1 |
| InChIKey | WCBOKWNPJUNJIZ-WAVNSJDCSA-N |
| XLogP | 4.11 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|