C19H26FN3O3S — CID 23328042
2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 23328042) has the molecular formula C19H26FN3O3S and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 23328042 |
| Molecular Formula | C19H26FN3O3S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CN(CC(=O)N/N=C1/C[C@H]2CC[C@@]1(C)C2(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN3O3S/c1-18(2)13-9-10-19(18,3)16(11-13)21-22-17(24)12-23(4)27(25,26)15-7-5-14(20)6-8-15/h5-8,13H,9-12H2,1-4H3,(H,22,24)/b21-16-/t13-,19-/m1/s1 |
| InChIKey | UOSPFDUBFRDFHP-MOXWAMRRSA-N |
| XLogP | 2.76 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|